About 2-(trifluoromethyl)-1,3-benzothiazole-6-carbonitrile
2-(trifluoromethyl)-1,3-benzothiazole-6-carbonitrile (PubChem CID 91882986) has the molecular formula C9H3F3N2S
and a molecular weight of 228.20 g/mol. Its IUPAC name is 2-(trifluoromethyl)-1,3-benzothiazole-6-carbonitrile.
Molecular Properties
| Compound Name | 2-(trifluoromethyl)-1,3-benzothiazole-6-carbonitrile |
| PubChem CID | 91882986 |
| Molecular Formula | C9H3F3N2S |
| Molecular Weight | 228.20 g/mol |
| Exact Mass | 228.00 |
| IUPAC Name | 2-(trifluoromethyl)-1,3-benzothiazole-6-carbonitrile |
| SMILES | N#Cc1ccc2nc(C(F)(F)F)sc2c1 |
| InChI | InChI=1S/C9H3F3N2S/c10-9(11,12)8-14-6-2-1-5(4-13)3-7(6)15-8/h1-3H |
| InChIKey | YJKPNMFSTDCJRV-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.20 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(trifluoromethyl)-1,3-benzothiazole-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(trifluoromethyl)-1,3-benzothiazole-6-carbonitrile?
The IUPAC name of 2-(trifluoromethyl)-1,3-benzothiazole-6-carbonitrile (CID 91882986) is 2-(trifluoromethyl)-1,3-benzothiazole-6-carbonitrile.
What is the SMILES notation for 2-(trifluoromethyl)-1,3-benzothiazole-6-carbonitrile?
The canonical SMILES for 2-(trifluoromethyl)-1,3-benzothiazole-6-carbonitrile is N#Cc1ccc2nc(C(F)(F)F)sc2c1.
What is the InChIKey of 2-(trifluoromethyl)-1,3-benzothiazole-6-carbonitrile?
The InChIKey is YJKPNMFSTDCJRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H3F3N2S/c10-9(11,12)8-14-6-2-1-5(4-13)3-7(6)15-8/h1-3H.
What are the key properties of 2-(trifluoromethyl)-1,3-benzothiazole-6-carbonitrile?
2-(trifluoromethyl)-1,3-benzothiazole-6-carbonitrile has a molecular weight of 228.20 g/mol, XLogP of 3.19, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(trifluoromethyl)-1,3-benzothiazole-6-carbonitrile is sourced from PubChem (CID 91882986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).