C11H10ClF3O — CID 91884155
3-[4-chloro-2-(trifluoromethyl)phenyl]-2-methylpropanal (PubChem CID 91884155) has the molecular formula C11H10ClF3O and a molecular weight of 250.65 g/mol. Its IUPAC name is 3-[4-chloro-2-(trifluoromethyl)phenyl]-2-methylpropanal.
| Compound Name | 3-[4-chloro-2-(trifluoromethyl)phenyl]-2-methylpropanal |
|---|---|
| PubChem CID | 91884155 |
| Molecular Formula | C11H10ClF3O |
| Molecular Weight | 250.65 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | 3-[4-chloro-2-(trifluoromethyl)phenyl]-2-methylpropanal |
| SMILES | CC(C=O)Cc1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C11H10ClF3O/c1-7(6-16)4-8-2-3-9(12)5-10(8)11(13,14)15/h2-3,5-7H,4H2,1H3 |
| InChIKey | JBIGVPOVFGXFJC-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.65 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|