About 2-[(3S)-2,3-bis(hydroxymethyl)cyclopenten-1-yl]ethanol
2-[(3S)-2,3-bis(hydroxymethyl)cyclopenten-1-yl]ethanol (PubChem CID 91884924) has the molecular formula C9H16O3
and a molecular weight of 172.22 g/mol. Its IUPAC name is 2-[(3S)-2,3-bis(hydroxymethyl)cyclopenten-1-yl]ethanol.
Molecular Properties
| Compound Name | 2-[(3S)-2,3-bis(hydroxymethyl)cyclopenten-1-yl]ethanol |
| PubChem CID | 91884924 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | 2-[(3S)-2,3-bis(hydroxymethyl)cyclopenten-1-yl]ethanol |
| SMILES | OCCC1=C(CO)[C@@H](CO)CC1 |
| InChI | InChI=1S/C9H16O3/c10-4-3-7-1-2-8(5-11)9(7)6-12/h8,10-12H,1-6H2/t8-/m1/s1 |
| InChIKey | SNRXLUZYBRTVHL-MRVPVSSYSA-N |
| XLogP | 0.06 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3S)-2,3-bis(hydroxymethyl)cyclopenten-1-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3S)-2,3-bis(hydroxymethyl)cyclopenten-1-yl]ethanol?
The IUPAC name of 2-[(3S)-2,3-bis(hydroxymethyl)cyclopenten-1-yl]ethanol (CID 91884924) is 2-[(3S)-2,3-bis(hydroxymethyl)cyclopenten-1-yl]ethanol.
What is the SMILES notation for 2-[(3S)-2,3-bis(hydroxymethyl)cyclopenten-1-yl]ethanol?
The canonical SMILES for 2-[(3S)-2,3-bis(hydroxymethyl)cyclopenten-1-yl]ethanol is OCCC1=C(CO)[C@@H](CO)CC1.
What is the InChIKey of 2-[(3S)-2,3-bis(hydroxymethyl)cyclopenten-1-yl]ethanol?
The InChIKey is SNRXLUZYBRTVHL-MRVPVSSYSA-N. The full InChI is InChI=1S/C9H16O3/c10-4-3-7-1-2-8(5-11)9(7)6-12/h8,10-12H,1-6H2/t8-/m1/s1.
What are the key properties of 2-[(3S)-2,3-bis(hydroxymethyl)cyclopenten-1-yl]ethanol?
2-[(3S)-2,3-bis(hydroxymethyl)cyclopenten-1-yl]ethanol has a molecular weight of 172.22 g/mol, XLogP of 0.06, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3S)-2,3-bis(hydroxymethyl)cyclopenten-1-yl]ethanol is sourced from PubChem (CID 91884924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).