C40H38Br2F2N2O2S2 — CID 91885153
5,8-bis(5-bromothiophen-2-yl)-6,7-difluoro-2,3-bis(3-hexoxyphenyl)quinoxaline (PubChem CID 91885153) has the molecular formula C40H38Br2F2N2O2S2 and a molecular weight of 840.69 g/mol. Its IUPAC name is 5,8-bis(5-bromothiophen-2-yl)-6,7-difluoro-2,3-bis(3-hexoxyphenyl)quinoxaline.
| Compound Name | 5,8-bis(5-bromothiophen-2-yl)-6,7-difluoro-2,3-bis(3-hexoxyphenyl)quinoxaline |
|---|---|
| PubChem CID | 91885153 |
| Molecular Formula | C40H38Br2F2N2O2S2 |
| Molecular Weight | 840.69 g/mol |
| Exact Mass | 838.07 |
| IUPAC Name | 5,8-bis(5-bromothiophen-2-yl)-6,7-difluoro-2,3-bis(3-hexoxyphenyl)quinoxaline |
| SMILES | CCCCCCOc1cccc(-c2nc3c(-c4ccc(Br)s4)c(F)c(F)c(-c4ccc(Br)s4)c3nc2-c2cccc(OCCCCCC)c2)c1 |
| InChI | InChI=1S/C40H38Br2F2N2O2S2/c1-3-5-7-9-21-47-27-15-11-13-25(23-27)37-38(26-14-12-16-28(24-26)48-22-10-8-6-4-2)46-40-34(30-18-20-32(42)50-30)36(44)35(43)33(39(40)45-37)29-17-19-31(41)49-29/h11-20,23-24H,3-10,21-22H2,1-2H3 |
| InChIKey | LHZOONDTPDMAQE-UHFFFAOYSA-N |
| XLogP | 14.14 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 840.69 |
| LogP ≤ 5 | 14.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|