C11H12N4O4S — CID 9188540
1-[(5-methylsulfonyl-1,3,4-oxadiazol-2-yl)methyl]-3-phenylurea (PubChem CID 9188540) has the molecular formula C11H12N4O4S and a molecular weight of 296.31 g/mol. Its IUPAC name is 1-[(5-methylsulfonyl-1,3,4-oxadiazol-2-yl)methyl]-3-phenylurea.
| Compound Name | 1-[(5-methylsulfonyl-1,3,4-oxadiazol-2-yl)methyl]-3-phenylurea |
|---|---|
| PubChem CID | 9188540 |
| Molecular Formula | C11H12N4O4S |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 1-[(5-methylsulfonyl-1,3,4-oxadiazol-2-yl)methyl]-3-phenylurea |
| SMILES | CS(=O)(=O)c1nnc(CNC(=O)Nc2ccccc2)o1 |
| InChI | InChI=1S/C11H12N4O4S/c1-20(17,18)11-15-14-9(19-11)7-12-10(16)13-8-5-3-2-4-6-8/h2-6H,7H2,1H3,(H2,12,13,16) |
| InChIKey | DOWJNURGKBBGKD-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |