About 8-[3-cyclopropyl-2-(3-methylbutyl)cyclohexen-1-yl]-3,7-dimethyloctanoic acid
8-[3-cyclopropyl-2-(3-methylbutyl)cyclohexen-1-yl]-3,7-dimethyloctanoic acid (PubChem CID 91885511) has the molecular formula C24H42O2
and a molecular weight of 362.60 g/mol. Its IUPAC name is 8-[3-cyclopropyl-2-(3-methylbutyl)cyclohexen-1-yl]-3,7-dimethyloctanoic acid.
Molecular Properties
| Compound Name | 8-[3-cyclopropyl-2-(3-methylbutyl)cyclohexen-1-yl]-3,7-dimethyloctanoic acid |
| PubChem CID | 91885511 |
| Molecular Formula | C24H42O2 |
| Molecular Weight | 362.60 g/mol |
| Exact Mass | 362.32 |
| IUPAC Name | 8-[3-cyclopropyl-2-(3-methylbutyl)cyclohexen-1-yl]-3,7-dimethyloctanoic acid |
| SMILES | CC(C)CCC1=C(CC(C)CCCC(C)CC(=O)O)CCCC1C1CC1 |
| InChI | InChI=1S/C24H42O2/c1-17(2)11-14-23-21(9-6-10-22(23)20-12-13-20)15-18(3)7-5-8-19(4)16-24(25)26/h17-20,22H,5-16H2,1-4H3,(H,25,26) |
| InChIKey | MYXYRJCGZCEBDG-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.60 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 8-[3-cyclopropyl-2-(3-methylbutyl)cyclohexen-1-yl]-3,7-dimethyloctanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[3-cyclopropyl-2-(3-methylbutyl)cyclohexen-1-yl]-3,7-dimethyloctanoic acid?
The IUPAC name of 8-[3-cyclopropyl-2-(3-methylbutyl)cyclohexen-1-yl]-3,7-dimethyloctanoic acid (CID 91885511) is 8-[3-cyclopropyl-2-(3-methylbutyl)cyclohexen-1-yl]-3,7-dimethyloctanoic acid.
What is the SMILES notation for 8-[3-cyclopropyl-2-(3-methylbutyl)cyclohexen-1-yl]-3,7-dimethyloctanoic acid?
The canonical SMILES for 8-[3-cyclopropyl-2-(3-methylbutyl)cyclohexen-1-yl]-3,7-dimethyloctanoic acid is CC(C)CCC1=C(CC(C)CCCC(C)CC(=O)O)CCCC1C1CC1.
What is the InChIKey of 8-[3-cyclopropyl-2-(3-methylbutyl)cyclohexen-1-yl]-3,7-dimethyloctanoic acid?
The InChIKey is MYXYRJCGZCEBDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H42O2/c1-17(2)11-14-23-21(9-6-10-22(23)20-12-13-20)15-18(3)7-5-8-19(4)16-24(25)26/h17-20,22H,5-16H2,1-4H3,(H,25,26).
What are the key properties of 8-[3-cyclopropyl-2-(3-methylbutyl)cyclohexen-1-yl]-3,7-dimethyloctanoic acid?
8-[3-cyclopropyl-2-(3-methylbutyl)cyclohexen-1-yl]-3,7-dimethyloctanoic acid has a molecular weight of 362.60 g/mol, XLogP of 7.24, 12 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[3-cyclopropyl-2-(3-methylbutyl)cyclohexen-1-yl]-3,7-dimethyloctanoic acid is sourced from PubChem (CID 91885511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).