C18H20N4O4S — CID 91887101
1-[(5-pentan-3-yl-1,2,4-oxadiazol-3-yl)methyl]-4-thiophen-2-yl-4,7-dihydro-3H-furo[3,4-d]pyrimidine-2,5-dione (PubChem CID 91887101) has the molecular formula C18H20N4O4S and a molecular weight of 388.45 g/mol. Its IUPAC name is 1-[(5-pentan-3-yl-1,2,4-oxadiazol-3-yl)methyl]-4-thiophen-2-yl-4,7-dihydro-3H-furo[3,4-d]pyrimidine-2,5-dione.
| Compound Name | 1-[(5-pentan-3-yl-1,2,4-oxadiazol-3-yl)methyl]-4-thiophen-2-yl-4,7-dihydro-3H-furo[3,4-d]pyrimidine-2,5-dione |
|---|---|
| PubChem CID | 91887101 |
| Molecular Formula | C18H20N4O4S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 1-[(5-pentan-3-yl-1,2,4-oxadiazol-3-yl)methyl]-4-thiophen-2-yl-4,7-dihydro-3H-furo[3,4-d]pyrimidine-2,5-dione |
| SMILES | CCC(CC)c1nc(CN2C(=O)NC(c3cccs3)C3=C2COC3=O)no1 |
| InChI | InChI=1S/C18H20N4O4S/c1-3-10(4-2)16-19-13(21-26-16)8-22-11-9-25-17(23)14(11)15(20-18(22)24)12-6-5-7-27-12/h5-7,10,15H,3-4,8-9H2,1-2H3,(H,20,24) |
| InChIKey | TXEPUXANERSADG-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 97.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |