About N-[1-[5-(4-fluorophenyl)-1H-pyrazol-3-yl]piperidin-3-yl]-3,5-dimethylbenzamide
N-[1-[5-(4-fluorophenyl)-1H-pyrazol-3-yl]piperidin-3-yl]-3,5-dimethylbenzamide (PubChem CID 91887872) has the molecular formula C23H25FN4O
and a molecular weight of 392.48 g/mol. Its IUPAC name is N-[1-[5-(4-fluorophenyl)-1H-pyrazol-3-yl]piperidin-3-yl]-3,5-dimethylbenzamide.
Molecular Properties
| Compound Name | N-[1-[5-(4-fluorophenyl)-1H-pyrazol-3-yl]piperidin-3-yl]-3,5-dimethylbenzamide |
| PubChem CID | 91887872 |
| Molecular Formula | C23H25FN4O |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | N-[1-[5-(4-fluorophenyl)-1H-pyrazol-3-yl]piperidin-3-yl]-3,5-dimethylbenzamide |
| SMILES | Cc1cc(C)cc(C(=O)NC2CCCN(c3cc(-c4ccc(F)cc4)[nH]n3)C2)c1 |
| InChI | InChI=1S/C23H25FN4O/c1-15-10-16(2)12-18(11-15)23(29)25-20-4-3-9-28(14-20)22-13-21(26-27-22)17-5-7-19(24)8-6-17/h5-8,10-13,20H,3-4,9,14H2,1-2H3,(H,25,29)(H,26,27) |
| InChIKey | CZIOSNNQRCTYQV-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[1-[5-(4-fluorophenyl)-1H-pyrazol-3-yl]piperidin-3-yl]-3,5-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[5-(4-fluorophenyl)-1H-pyrazol-3-yl]piperidin-3-yl]-3,5-dimethylbenzamide?
The IUPAC name of N-[1-[5-(4-fluorophenyl)-1H-pyrazol-3-yl]piperidin-3-yl]-3,5-dimethylbenzamide (CID 91887872) is N-[1-[5-(4-fluorophenyl)-1H-pyrazol-3-yl]piperidin-3-yl]-3,5-dimethylbenzamide.
What is the SMILES notation for N-[1-[5-(4-fluorophenyl)-1H-pyrazol-3-yl]piperidin-3-yl]-3,5-dimethylbenzamide?
The canonical SMILES for N-[1-[5-(4-fluorophenyl)-1H-pyrazol-3-yl]piperidin-3-yl]-3,5-dimethylbenzamide is Cc1cc(C)cc(C(=O)NC2CCCN(c3cc(-c4ccc(F)cc4)[nH]n3)C2)c1.
What is the InChIKey of N-[1-[5-(4-fluorophenyl)-1H-pyrazol-3-yl]piperidin-3-yl]-3,5-dimethylbenzamide?
The InChIKey is CZIOSNNQRCTYQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25FN4O/c1-15-10-16(2)12-18(11-15)23(29)25-20-4-3-9-28(14-20)22-13-21(26-27-22)17-5-7-19(24)8-6-17/h5-8,10-13,20H,3-4,9,14H2,1-2H3,(H,25,29)(H,26,27).
What are the key properties of N-[1-[5-(4-fluorophenyl)-1H-pyrazol-3-yl]piperidin-3-yl]-3,5-dimethylbenzamide?
N-[1-[5-(4-fluorophenyl)-1H-pyrazol-3-yl]piperidin-3-yl]-3,5-dimethylbenzamide has a molecular weight of 392.48 g/mol, XLogP of 4.23, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[5-(4-fluorophenyl)-1H-pyrazol-3-yl]piperidin-3-yl]-3,5-dimethylbenzamide is sourced from PubChem (CID 91887872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).