C20H19ClN4O — CID 91889019
2-(2-chlorophenyl)-N-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)phenyl]acetamide (PubChem CID 91889019) has the molecular formula C20H19ClN4O and a molecular weight of 366.85 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)phenyl]acetamide.
| Compound Name | 2-(2-chlorophenyl)-N-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 91889019 |
| Molecular Formula | C20H19ClN4O |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 2-(2-chlorophenyl)-N-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)phenyl]acetamide |
| SMILES | O=C(Cc1ccccc1Cl)Nc1ccc(-c2nnc3n2CCCC3)cc1 |
| InChI | InChI=1S/C20H19ClN4O/c21-17-6-2-1-5-15(17)13-19(26)22-16-10-8-14(9-11-16)20-24-23-18-7-3-4-12-25(18)20/h1-2,5-6,8-11H,3-4,7,12-13H2,(H,22,26) |
| InChIKey | JMDCOWURZXDRQY-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |