C21H18ClN5O4 — CID 91889312
6-(4-chlorophenyl)-3-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazine (PubChem CID 91889312) has the molecular formula C21H18ClN5O4 and a molecular weight of 439.86 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-3-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazine.
| Compound Name | 6-(4-chlorophenyl)-3-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazine |
|---|---|
| PubChem CID | 91889312 |
| Molecular Formula | C21H18ClN5O4 |
| Molecular Weight | 439.86 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | 6-(4-chlorophenyl)-3-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazine |
| SMILES | COc1ccc(-c2noc(-c3nnn4c3COC(c3ccc(Cl)cc3)C4)n2)cc1OC |
| InChI | InChI=1S/C21H18ClN5O4/c1-28-16-8-5-13(9-17(16)29-2)20-23-21(31-25-20)19-15-11-30-18(10-27(15)26-24-19)12-3-6-14(22)7-4-12/h3-9,18H,10-11H2,1-2H3 |
| InChIKey | YZCINWNUPFGICJ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 97.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.86 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |