C20H26N4O2 — CID 91890108
N-[2-(cyclohexen-1-yl)ethyl]-2-(1-oxo-7,8,9,10-tetrahydropyrazino[1,2-b]indazol-2-yl)acetamide (PubChem CID 91890108) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-(1-oxo-7,8,9,10-tetrahydropyrazino[1,2-b]indazol-2-yl)acetamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-(1-oxo-7,8,9,10-tetrahydropyrazino[1,2-b]indazol-2-yl)acetamide |
|---|---|
| PubChem CID | 91890108 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-(1-oxo-7,8,9,10-tetrahydropyrazino[1,2-b]indazol-2-yl)acetamide |
| SMILES | O=C(Cn1ccn2nc3c(c2c1=O)CCCC3)NCCC1=CCCCC1 |
| InChI | InChI=1S/C20H26N4O2/c25-18(21-11-10-15-6-2-1-3-7-15)14-23-12-13-24-19(20(23)26)16-8-4-5-9-17(16)22-24/h6,12-13H,1-5,7-11,14H2,(H,21,25) |
| InChIKey | XEFUSRYPQAIBHR-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 68.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|