C24H22N4O4 — CID 91890492
2-[(4-methoxyphenyl)methyl]-4-(5-phenyl-1,2,4-oxadiazol-3-yl)-5,6,7,8-tetrahydropyrido[1,2-c]pyrimidine-1,3-dione (PubChem CID 91890492) has the molecular formula C24H22N4O4 and a molecular weight of 430.46 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)methyl]-4-(5-phenyl-1,2,4-oxadiazol-3-yl)-5,6,7,8-tetrahydropyrido[1,2-c]pyrimidine-1,3-dione.
| Compound Name | 2-[(4-methoxyphenyl)methyl]-4-(5-phenyl-1,2,4-oxadiazol-3-yl)-5,6,7,8-tetrahydropyrido[1,2-c]pyrimidine-1,3-dione |
|---|---|
| PubChem CID | 91890492 |
| Molecular Formula | C24H22N4O4 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 2-[(4-methoxyphenyl)methyl]-4-(5-phenyl-1,2,4-oxadiazol-3-yl)-5,6,7,8-tetrahydropyrido[1,2-c]pyrimidine-1,3-dione |
| SMILES | COc1ccc(Cn2c(=O)c(-c3noc(-c4ccccc4)n3)c3n(c2=O)CCCC3)cc1 |
| InChI | InChI=1S/C24H22N4O4/c1-31-18-12-10-16(11-13-18)15-28-23(29)20(19-9-5-6-14-27(19)24(28)30)21-25-22(32-26-21)17-7-3-2-4-8-17/h2-4,7-8,10-13H,5-6,9,14-15H2,1H3 |
| InChIKey | VWKIEYJUQBCDAD-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 92.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |