C20H15F2N5O3 — CID 91891563
3-[5-(2,5-difluorophenyl)-1,2,4-oxadiazol-3-yl]-6-(4-methoxyphenyl)-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazine (PubChem CID 91891563) has the molecular formula C20H15F2N5O3 and a molecular weight of 411.37 g/mol. Its IUPAC name is 3-[5-(2,5-difluorophenyl)-1,2,4-oxadiazol-3-yl]-6-(4-methoxyphenyl)-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazine.
| Compound Name | 3-[5-(2,5-difluorophenyl)-1,2,4-oxadiazol-3-yl]-6-(4-methoxyphenyl)-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazine |
|---|---|
| PubChem CID | 91891563 |
| Molecular Formula | C20H15F2N5O3 |
| Molecular Weight | 411.37 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | 3-[5-(2,5-difluorophenyl)-1,2,4-oxadiazol-3-yl]-6-(4-methoxyphenyl)-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazine |
| SMILES | COc1ccc(C2Cn3nnc(-c4noc(-c5cc(F)ccc5F)n4)c3CO2)cc1 |
| InChI | InChI=1S/C20H15F2N5O3/c1-28-13-5-2-11(3-6-13)17-9-27-16(10-29-17)18(24-26-27)19-23-20(30-25-19)14-8-12(21)4-7-15(14)22/h2-8,17H,9-10H2,1H3 |
| InChIKey | RNWJNPDCJSBBGC-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 88.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.37 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |