C18H19N5O — CID 91892565
N-cyclohexyl-5-(3-phenyl-1,2,4-oxadiazol-5-yl)pyrimidin-4-amine (PubChem CID 91892565) has the molecular formula C18H19N5O and a molecular weight of 321.38 g/mol. Its IUPAC name is N-cyclohexyl-5-(3-phenyl-1,2,4-oxadiazol-5-yl)pyrimidin-4-amine.
| Compound Name | N-cyclohexyl-5-(3-phenyl-1,2,4-oxadiazol-5-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 91892565 |
| Molecular Formula | C18H19N5O |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | N-cyclohexyl-5-(3-phenyl-1,2,4-oxadiazol-5-yl)pyrimidin-4-amine |
| SMILES | c1ccc(-c2noc(-c3cncnc3NC3CCCCC3)n2)cc1 |
| InChI | InChI=1S/C18H19N5O/c1-3-7-13(8-4-1)16-22-18(24-23-16)15-11-19-12-20-17(15)21-14-9-5-2-6-10-14/h1,3-4,7-8,11-12,14H,2,5-6,9-10H2,(H,19,20,21) |
| InChIKey | DMJNTXZYBWFCGW-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 76.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |