C19H21N5O — CID 91892596
N-cycloheptyl-5-(3-phenyl-1,2,4-oxadiazol-5-yl)pyrimidin-4-amine (PubChem CID 91892596) has the molecular formula C19H21N5O and a molecular weight of 335.41 g/mol. Its IUPAC name is N-cycloheptyl-5-(3-phenyl-1,2,4-oxadiazol-5-yl)pyrimidin-4-amine.
| Compound Name | N-cycloheptyl-5-(3-phenyl-1,2,4-oxadiazol-5-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 91892596 |
| Molecular Formula | C19H21N5O |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | N-cycloheptyl-5-(3-phenyl-1,2,4-oxadiazol-5-yl)pyrimidin-4-amine |
| SMILES | c1ccc(-c2noc(-c3cncnc3NC3CCCCCC3)n2)cc1 |
| InChI | InChI=1S/C19H21N5O/c1-2-7-11-15(10-6-1)22-18-16(12-20-13-21-18)19-23-17(24-25-19)14-8-4-3-5-9-14/h3-5,8-9,12-13,15H,1-2,6-7,10-11H2,(H,20,21,22) |
| InChIKey | VRKAHFJREKOCJL-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 76.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |