C20H18N6O — CID 91892621
4-N,4-N-dimethyl-1-N-[5-(3-phenyl-1,2,4-oxadiazol-5-yl)pyrimidin-4-yl]benzene-1,4-diamine (PubChem CID 91892621) has the molecular formula C20H18N6O and a molecular weight of 358.41 g/mol. Its IUPAC name is 4-N,4-N-dimethyl-1-N-[5-(3-phenyl-1,2,4-oxadiazol-5-yl)pyrimidin-4-yl]benzene-1,4-diamine.
| Compound Name | 4-N,4-N-dimethyl-1-N-[5-(3-phenyl-1,2,4-oxadiazol-5-yl)pyrimidin-4-yl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 91892621 |
| Molecular Formula | C20H18N6O |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 4-N,4-N-dimethyl-1-N-[5-(3-phenyl-1,2,4-oxadiazol-5-yl)pyrimidin-4-yl]benzene-1,4-diamine |
| SMILES | CN(C)c1ccc(Nc2ncncc2-c2nc(-c3ccccc3)no2)cc1 |
| InChI | InChI=1S/C20H18N6O/c1-26(2)16-10-8-15(9-11-16)23-19-17(12-21-13-22-19)20-24-18(25-27-20)14-6-4-3-5-7-14/h3-13H,1-2H3,(H,21,22,23) |
| InChIKey | CWWVZATZUPDDPK-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 79.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|