C19H18N6O2 — CID 91893142
3,5-dimethyl-N-[[8-(3-methyl-1,2,4-oxadiazol-5-yl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]benzamide (PubChem CID 91893142) has the molecular formula C19H18N6O2 and a molecular weight of 362.39 g/mol. Its IUPAC name is 3,5-dimethyl-N-[[8-(3-methyl-1,2,4-oxadiazol-5-yl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]benzamide.
| Compound Name | 3,5-dimethyl-N-[[8-(3-methyl-1,2,4-oxadiazol-5-yl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 91893142 |
| Molecular Formula | C19H18N6O2 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 3,5-dimethyl-N-[[8-(3-methyl-1,2,4-oxadiazol-5-yl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]benzamide |
| SMILES | Cc1cc(C)cc(C(=O)NCc2nnc3c(-c4nc(C)no4)cccn23)c1 |
| InChI | InChI=1S/C19H18N6O2/c1-11-7-12(2)9-14(8-11)18(26)20-10-16-22-23-17-15(5-4-6-25(16)17)19-21-13(3)24-27-19/h4-9H,10H2,1-3H3,(H,20,26) |
| InChIKey | OFGRXSJVOGZNCI-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |