C19H17N5O2 — CID 918932
2-amino-N-(furan-2-ylmethyl)-1-prop-2-enylpyrrolo[3,2-b]quinoxaline-3-carboxamide (PubChem CID 918932) has the molecular formula C19H17N5O2 and a molecular weight of 347.38 g/mol. Its IUPAC name is 2-amino-N-(furan-2-ylmethyl)-1-prop-2-enylpyrrolo[3,2-b]quinoxaline-3-carboxamide.
| Compound Name | 2-amino-N-(furan-2-ylmethyl)-1-prop-2-enylpyrrolo[3,2-b]quinoxaline-3-carboxamide |
|---|---|
| PubChem CID | 918932 |
| Molecular Formula | C19H17N5O2 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 2-amino-N-(furan-2-ylmethyl)-1-prop-2-enylpyrrolo[3,2-b]quinoxaline-3-carboxamide |
| SMILES | C=CCn1c(N)c(C(=O)NCc2ccco2)c2nc3ccccc3nc21 |
| InChI | InChI=1S/C19H17N5O2/c1-2-9-24-17(20)15(19(25)21-11-12-6-5-10-26-12)16-18(24)23-14-8-4-3-7-13(14)22-16/h2-8,10H,1,9,11,20H2,(H,21,25) |
| InChIKey | UPXLJKCRGCSAMC-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 98.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|