C18H20N6O — CID 91893650
3-methyl-5-[4-[4-(4-methylphenyl)piperazin-1-yl]pyrimidin-5-yl]-1,2,4-oxadiazole (PubChem CID 91893650) has the molecular formula C18H20N6O and a molecular weight of 336.40 g/mol. Its IUPAC name is 3-methyl-5-[4-[4-(4-methylphenyl)piperazin-1-yl]pyrimidin-5-yl]-1,2,4-oxadiazole.
| Compound Name | 3-methyl-5-[4-[4-(4-methylphenyl)piperazin-1-yl]pyrimidin-5-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 91893650 |
| Molecular Formula | C18H20N6O |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 3-methyl-5-[4-[4-(4-methylphenyl)piperazin-1-yl]pyrimidin-5-yl]-1,2,4-oxadiazole |
| SMILES | Cc1ccc(N2CCN(c3ncncc3-c3nc(C)no3)CC2)cc1 |
| InChI | InChI=1S/C18H20N6O/c1-13-3-5-15(6-4-13)23-7-9-24(10-8-23)17-16(11-19-12-20-17)18-21-14(2)22-25-18/h3-6,11-12H,7-10H2,1-2H3 |
| InChIKey | WSNNOFLNSRUJDN-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 71.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|