C20H13F3N4O2 — CID 91894259
1-[3-(3,4-difluorophenyl)-1,2,4-oxadiazol-5-yl]-6-(3-fluorophenyl)-6,8-dihydro-5H-imidazo[5,1-c][1,4]oxazine (PubChem CID 91894259) has the molecular formula C20H13F3N4O2 and a molecular weight of 398.34 g/mol. Its IUPAC name is 1-[3-(3,4-difluorophenyl)-1,2,4-oxadiazol-5-yl]-6-(3-fluorophenyl)-6,8-dihydro-5H-imidazo[5,1-c][1,4]oxazine.
| Compound Name | 1-[3-(3,4-difluorophenyl)-1,2,4-oxadiazol-5-yl]-6-(3-fluorophenyl)-6,8-dihydro-5H-imidazo[5,1-c][1,4]oxazine |
|---|---|
| PubChem CID | 91894259 |
| Molecular Formula | C20H13F3N4O2 |
| Molecular Weight | 398.34 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 1-[3-(3,4-difluorophenyl)-1,2,4-oxadiazol-5-yl]-6-(3-fluorophenyl)-6,8-dihydro-5H-imidazo[5,1-c][1,4]oxazine |
| SMILES | Fc1cccc(C2Cn3cnc(-c4nc(-c5ccc(F)c(F)c5)no4)c3CO2)c1 |
| InChI | InChI=1S/C20H13F3N4O2/c21-13-3-1-2-11(6-13)17-8-27-10-24-18(16(27)9-28-17)20-25-19(26-29-20)12-4-5-14(22)15(23)7-12/h1-7,10,17H,8-9H2 |
| InChIKey | HPXQNVZYGXPNQT-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 65.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.34 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |