About 4-[1-(5-chloro-2-oxo-1,3-dihydroindol-3-yl)ethylideneamino]benzenesulfonamide
4-[1-(5-chloro-2-oxo-1,3-dihydroindol-3-yl)ethylideneamino]benzenesulfonamide (PubChem CID 91895631) has the molecular formula C16H14ClN3O3S
and a molecular weight of 363.83 g/mol. Its IUPAC name is 4-[1-(5-chloro-2-oxo-1,3-dihydroindol-3-yl)ethylideneamino]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-[1-(5-chloro-2-oxo-1,3-dihydroindol-3-yl)ethylideneamino]benzenesulfonamide |
| PubChem CID | 91895631 |
| Molecular Formula | C16H14ClN3O3S |
| Molecular Weight | 363.83 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | 4-[1-(5-chloro-2-oxo-1,3-dihydroindol-3-yl)ethylideneamino]benzenesulfonamide |
| SMILES | C/C(=N\c1ccc(S(N)(=O)=O)cc1)C1C(=O)Nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C16H14ClN3O3S/c1-9(19-11-3-5-12(6-4-11)24(18,22)23)15-13-8-10(17)2-7-14(13)20-16(15)21/h2-8,15H,1H3,(H,20,21)(H2,18,22,23)/b19-9+ |
| InChIKey | ZXRPXMCCGHLXQY-DJKKODMXSA-N |
| XLogP | 2.82 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.83 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[1-(5-chloro-2-oxo-1,3-dihydroindol-3-yl)ethylideneamino]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(5-chloro-2-oxo-1,3-dihydroindol-3-yl)ethylideneamino]benzenesulfonamide?
The IUPAC name of 4-[1-(5-chloro-2-oxo-1,3-dihydroindol-3-yl)ethylideneamino]benzenesulfonamide (CID 91895631) is 4-[1-(5-chloro-2-oxo-1,3-dihydroindol-3-yl)ethylideneamino]benzenesulfonamide.
What is the SMILES notation for 4-[1-(5-chloro-2-oxo-1,3-dihydroindol-3-yl)ethylideneamino]benzenesulfonamide?
The canonical SMILES for 4-[1-(5-chloro-2-oxo-1,3-dihydroindol-3-yl)ethylideneamino]benzenesulfonamide is C/C(=N\c1ccc(S(N)(=O)=O)cc1)C1C(=O)Nc2ccc(Cl)cc21.
What is the InChIKey of 4-[1-(5-chloro-2-oxo-1,3-dihydroindol-3-yl)ethylideneamino]benzenesulfonamide?
The InChIKey is ZXRPXMCCGHLXQY-DJKKODMXSA-N. The full InChI is InChI=1S/C16H14ClN3O3S/c1-9(19-11-3-5-12(6-4-11)24(18,22)23)15-13-8-10(17)2-7-14(13)20-16(15)21/h2-8,15H,1H3,(H,20,21)(H2,18,22,23)/b19-9+.
What are the key properties of 4-[1-(5-chloro-2-oxo-1,3-dihydroindol-3-yl)ethylideneamino]benzenesulfonamide?
4-[1-(5-chloro-2-oxo-1,3-dihydroindol-3-yl)ethylideneamino]benzenesulfonamide has a molecular weight of 363.83 g/mol, XLogP of 2.82, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(5-chloro-2-oxo-1,3-dihydroindol-3-yl)ethylideneamino]benzenesulfonamide is sourced from PubChem (CID 91895631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).