C18H14N4O3S2 — CID 91895651
4-[(2-oxo-1,3-dihydroindol-3-yl)methylideneamino]-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 91895651) has the molecular formula C18H14N4O3S2 and a molecular weight of 398.47 g/mol. Its IUPAC name is 4-[(2-oxo-1,3-dihydroindol-3-yl)methylideneamino]-N-(1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 4-[(2-oxo-1,3-dihydroindol-3-yl)methylideneamino]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 91895651 |
| Molecular Formula | C18H14N4O3S2 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | 4-[(2-oxo-1,3-dihydroindol-3-yl)methylideneamino]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | O=C1Nc2ccccc2C1/C=N/c1ccc(S(=O)(=O)Nc2nccs2)cc1 |
| InChI | InChI=1S/C18H14N4O3S2/c23-17-15(14-3-1-2-4-16(14)21-17)11-20-12-5-7-13(8-6-12)27(24,25)22-18-19-9-10-26-18/h1-11,15H,(H,19,22)(H,21,23)/b20-11+ |
| InChIKey | FMWOSOQYOAWCGC-RGVLZGJSSA-N |
| XLogP | 3.38 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|