C18H12F3N7O — CID 91895683
pyridin-4-ylmethyl-[1-[3-(trifluoromethoxy)phenyl]pyrazolo[3,4-d]pyrimidin-4-yl]diazene (PubChem CID 91895683) has the molecular formula C18H12F3N7O and a molecular weight of 399.34 g/mol. Its IUPAC name is pyridin-4-ylmethyl-[1-[3-(trifluoromethoxy)phenyl]pyrazolo[3,4-d]pyrimidin-4-yl]diazene.
| Compound Name | pyridin-4-ylmethyl-[1-[3-(trifluoromethoxy)phenyl]pyrazolo[3,4-d]pyrimidin-4-yl]diazene |
|---|---|
| PubChem CID | 91895683 |
| Molecular Formula | C18H12F3N7O |
| Molecular Weight | 399.34 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | pyridin-4-ylmethyl-[1-[3-(trifluoromethoxy)phenyl]pyrazolo[3,4-d]pyrimidin-4-yl]diazene |
| SMILES | FC(F)(F)Oc1cccc(-n2ncc3c(/N=N/Cc4ccncc4)ncnc32)c1 |
| InChI | InChI=1S/C18H12F3N7O/c19-18(20,21)29-14-3-1-2-13(8-14)28-17-15(10-26-28)16(23-11-24-17)27-25-9-12-4-6-22-7-5-12/h1-8,10-11H,9H2/b27-25+ |
| InChIKey | PSUMBGPAZYSXSK-IMVLJIQESA-N |
| XLogP | 4.39 |
| TPSA | 90.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.34 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|