C23H28FN6O2+ — CID 91895719
[(2S,3S)-4-(dimethylamino)-1-[(3S)-3-fluoropyrrolidin-1-yl]-3-[4-(2-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)phenyl]-1,4-dioxobutan-2-yl]azanium (PubChem CID 91895719) has the molecular formula C23H28FN6O2+ and a molecular weight of 439.52 g/mol. Its IUPAC name is [(2S,3S)-4-(dimethylamino)-1-[(3S)-3-fluoropyrrolidin-1-yl]-3-[4-(2-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)phenyl]-1,4-dioxobutan-2-yl]azanium.
| Compound Name | [(2S,3S)-4-(dimethylamino)-1-[(3S)-3-fluoropyrrolidin-1-yl]-3-[4-(2-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)phenyl]-1,4-dioxobutan-2-yl]azanium |
|---|---|
| PubChem CID | 91895719 |
| Molecular Formula | C23H28FN6O2+ |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | [(2S,3S)-4-(dimethylamino)-1-[(3S)-3-fluoropyrrolidin-1-yl]-3-[4-(2-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)phenyl]-1,4-dioxobutan-2-yl]azanium |
| SMILES | Cc1nc2ccc(-c3ccc([C@H](C(=O)N(C)C)[C@H]([NH3+])C(=O)N4CC[C@H](F)C4)cc3)cn2n1 |
| InChI | InChI=1S/C23H27FN6O2/c1-14-26-19-9-8-17(12-30(19)27-14)15-4-6-16(7-5-15)20(22(31)28(2)3)21(25)23(32)29-11-10-18(24)13-29/h4-9,12,18,20-21H,10-11,13,25H2,1-3H3/p+1/t18-,20-,21-/m0/s1 |
| InChIKey | RQEAREZVNCJRJQ-JBACZVJFSA-O |
| XLogP | 1.06 |
| TPSA | 98.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |