About 3-(4,6-dimethylpyrimidin-2-yl)sulfanyl-1-(4-ethoxyphenyl)pyrrole-2,5-diol
3-(4,6-dimethylpyrimidin-2-yl)sulfanyl-1-(4-ethoxyphenyl)pyrrole-2,5-diol (PubChem CID 91895790) has the molecular formula C18H19N3O3S
and a molecular weight of 357.44 g/mol. Its IUPAC name is 3-(4,6-dimethylpyrimidin-2-yl)sulfanyl-1-(4-ethoxyphenyl)pyrrole-2,5-diol.
Molecular Properties
| Compound Name | 3-(4,6-dimethylpyrimidin-2-yl)sulfanyl-1-(4-ethoxyphenyl)pyrrole-2,5-diol |
| PubChem CID | 91895790 |
| Molecular Formula | C18H19N3O3S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 3-(4,6-dimethylpyrimidin-2-yl)sulfanyl-1-(4-ethoxyphenyl)pyrrole-2,5-diol |
| SMILES | CCOc1ccc(-n2c(O)cc(Sc3nc(C)cc(C)n3)c2O)cc1 |
| InChI | InChI=1S/C18H19N3O3S/c1-4-24-14-7-5-13(6-8-14)21-16(22)10-15(17(21)23)25-18-19-11(2)9-12(3)20-18/h5-10,22-23H,4H2,1-3H3 |
| InChIKey | RMGUDEJOXAUCMU-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-(4,6-dimethylpyrimidin-2-yl)sulfanyl-1-(4-ethoxyphenyl)pyrrole-2,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4,6-dimethylpyrimidin-2-yl)sulfanyl-1-(4-ethoxyphenyl)pyrrole-2,5-diol?
The IUPAC name of 3-(4,6-dimethylpyrimidin-2-yl)sulfanyl-1-(4-ethoxyphenyl)pyrrole-2,5-diol (CID 91895790) is 3-(4,6-dimethylpyrimidin-2-yl)sulfanyl-1-(4-ethoxyphenyl)pyrrole-2,5-diol.
What is the SMILES notation for 3-(4,6-dimethylpyrimidin-2-yl)sulfanyl-1-(4-ethoxyphenyl)pyrrole-2,5-diol?
The canonical SMILES for 3-(4,6-dimethylpyrimidin-2-yl)sulfanyl-1-(4-ethoxyphenyl)pyrrole-2,5-diol is CCOc1ccc(-n2c(O)cc(Sc3nc(C)cc(C)n3)c2O)cc1.
What is the InChIKey of 3-(4,6-dimethylpyrimidin-2-yl)sulfanyl-1-(4-ethoxyphenyl)pyrrole-2,5-diol?
The InChIKey is RMGUDEJOXAUCMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N3O3S/c1-4-24-14-7-5-13(6-8-14)21-16(22)10-15(17(21)23)25-18-19-11(2)9-12(3)20-18/h5-10,22-23H,4H2,1-3H3.
What are the key properties of 3-(4,6-dimethylpyrimidin-2-yl)sulfanyl-1-(4-ethoxyphenyl)pyrrole-2,5-diol?
3-(4,6-dimethylpyrimidin-2-yl)sulfanyl-1-(4-ethoxyphenyl)pyrrole-2,5-diol has a molecular weight of 357.44 g/mol, XLogP of 3.85, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,6-dimethylpyrimidin-2-yl)sulfanyl-1-(4-ethoxyphenyl)pyrrole-2,5-diol is sourced from PubChem (CID 91895790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).