C18H19ClN+ — CID 91895870
[(1S,6R)-6-(2-chlorophenyl)-3-phenylcyclohex-3-en-1-yl]azanium (PubChem CID 91895870) has the molecular formula C18H19ClN+ and a molecular weight of 284.81 g/mol. Its IUPAC name is [(1S,6R)-6-(2-chlorophenyl)-3-phenylcyclohex-3-en-1-yl]azanium.
| Compound Name | [(1S,6R)-6-(2-chlorophenyl)-3-phenylcyclohex-3-en-1-yl]azanium |
|---|---|
| PubChem CID | 91895870 |
| Molecular Formula | C18H19ClN+ |
| Molecular Weight | 284.81 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | [(1S,6R)-6-(2-chlorophenyl)-3-phenylcyclohex-3-en-1-yl]azanium |
| SMILES | [NH3+][C@H]1CC(c2ccccc2)=CC[C@@H]1c1ccccc1Cl |
| InChI | InChI=1S/C18H18ClN/c19-17-9-5-4-8-15(17)16-11-10-14(12-18(16)20)13-6-2-1-3-7-13/h1-10,16,18H,11-12,20H2/p+1/t16-,18+/m1/s1 |
| InChIKey | XJEZQQZKQBCUQB-AEFFLSMTSA-O |
| XLogP | 3.91 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.81 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |