C20H21F3N3O+ — CID 91895873
[(1S,6R)-3-[(3-carbamoylanilino)methyl]-6-(2,4,5-trifluorophenyl)cyclohex-3-en-1-yl]azanium (PubChem CID 91895873) has the molecular formula C20H21F3N3O+ and a molecular weight of 376.40 g/mol. Its IUPAC name is [(1S,6R)-3-[(3-carbamoylanilino)methyl]-6-(2,4,5-trifluorophenyl)cyclohex-3-en-1-yl]azanium.
| Compound Name | [(1S,6R)-3-[(3-carbamoylanilino)methyl]-6-(2,4,5-trifluorophenyl)cyclohex-3-en-1-yl]azanium |
|---|---|
| PubChem CID | 91895873 |
| Molecular Formula | C20H21F3N3O+ |
| Molecular Weight | 376.40 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | [(1S,6R)-3-[(3-carbamoylanilino)methyl]-6-(2,4,5-trifluorophenyl)cyclohex-3-en-1-yl]azanium |
| SMILES | NC(=O)c1cccc(NCC2=CC[C@H](c3cc(F)c(F)cc3F)[C@@H]([NH3+])C2)c1 |
| InChI | InChI=1S/C20H20F3N3O/c21-16-9-18(23)17(22)8-15(16)14-5-4-11(6-19(14)24)10-26-13-3-1-2-12(7-13)20(25)27/h1-4,7-9,14,19,26H,5-6,10,24H2,(H2,25,27)/p+1/t14-,19+/m1/s1 |
| InChIKey | VDIQELAZMIFVDS-KUHUBIRLSA-O |
| XLogP | 2.73 |
| TPSA | 82.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.40 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|