C20H19F3N3O2+ — CID 91895875
[(1S,6R)-3-[(3-carbamoylphenyl)carbamoyl]-6-(2,4,5-trifluorophenyl)cyclohex-3-en-1-yl]azanium (PubChem CID 91895875) has the molecular formula C20H19F3N3O2+ and a molecular weight of 390.39 g/mol. Its IUPAC name is [(1S,6R)-3-[(3-carbamoylphenyl)carbamoyl]-6-(2,4,5-trifluorophenyl)cyclohex-3-en-1-yl]azanium.
| Compound Name | [(1S,6R)-3-[(3-carbamoylphenyl)carbamoyl]-6-(2,4,5-trifluorophenyl)cyclohex-3-en-1-yl]azanium |
|---|---|
| PubChem CID | 91895875 |
| Molecular Formula | C20H19F3N3O2+ |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | [(1S,6R)-3-[(3-carbamoylphenyl)carbamoyl]-6-(2,4,5-trifluorophenyl)cyclohex-3-en-1-yl]azanium |
| SMILES | NC(=O)c1cccc(NC(=O)C2=CC[C@H](c3cc(F)c(F)cc3F)[C@@H]([NH3+])C2)c1 |
| InChI | InChI=1S/C20H18F3N3O2/c21-15-9-17(23)16(22)8-14(15)13-5-4-11(7-18(13)24)20(28)26-12-3-1-2-10(6-12)19(25)27/h1-4,6,8-9,13,18H,5,7,24H2,(H2,25,27)(H,26,28)/p+1/t13-,18+/m1/s1 |
| InChIKey | XXQAXMIQRFUFDQ-ACJLOTCBSA-O |
| XLogP | 2.26 |
| TPSA | 99.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|