C17H11ClN6O2 — CID 91895910
(6-chloro-1,3-benzodioxol-5-yl)methyl-(5H-[1,2,4]triazino[5,6-b]indol-3-yl)diazene (PubChem CID 91895910) has the molecular formula C17H11ClN6O2 and a molecular weight of 366.77 g/mol. Its IUPAC name is (6-chloro-1,3-benzodioxol-5-yl)methyl-(5H-[1,2,4]triazino[5,6-b]indol-3-yl)diazene.
| Compound Name | (6-chloro-1,3-benzodioxol-5-yl)methyl-(5H-[1,2,4]triazino[5,6-b]indol-3-yl)diazene |
|---|---|
| PubChem CID | 91895910 |
| Molecular Formula | C17H11ClN6O2 |
| Molecular Weight | 366.77 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | (6-chloro-1,3-benzodioxol-5-yl)methyl-(5H-[1,2,4]triazino[5,6-b]indol-3-yl)diazene |
| SMILES | Clc1cc2c(cc1C/N=N/c1nnc3c(n1)[nH]c1ccccc13)OCO2 |
| InChI | InChI=1S/C17H11ClN6O2/c18-11-6-14-13(25-8-26-14)5-9(11)7-19-23-17-21-16-15(22-24-17)10-3-1-2-4-12(10)20-16/h1-6H,7-8H2,(H,20,21,24)/b23-19+ |
| InChIKey | SCTVRXQQPWBIGS-FCDQGJHFSA-N |
| XLogP | 4.17 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.77 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|