About N-[2-chloro-4-(2,3-dichlorophenyl)phenyl]-2-cyano-3-oxobutanamide
N-[2-chloro-4-(2,3-dichlorophenyl)phenyl]-2-cyano-3-oxobutanamide (PubChem CID 91896056) has the molecular formula C17H11Cl3N2O2
and a molecular weight of 381.65 g/mol. Its IUPAC name is N-[2-chloro-4-(2,3-dichlorophenyl)phenyl]-2-cyano-3-oxobutanamide.
Molecular Properties
| Compound Name | N-[2-chloro-4-(2,3-dichlorophenyl)phenyl]-2-cyano-3-oxobutanamide |
| PubChem CID | 91896056 |
| Molecular Formula | C17H11Cl3N2O2 |
| Molecular Weight | 381.65 g/mol |
| Exact Mass | 379.99 |
| IUPAC Name | N-[2-chloro-4-(2,3-dichlorophenyl)phenyl]-2-cyano-3-oxobutanamide |
| SMILES | CC(=O)C(C#N)C(=O)Nc1ccc(-c2cccc(Cl)c2Cl)cc1Cl |
| InChI | InChI=1S/C17H11Cl3N2O2/c1-9(23)12(8-21)17(24)22-15-6-5-10(7-14(15)19)11-3-2-4-13(18)16(11)20/h2-7,12H,1H3,(H,22,24) |
| InChIKey | CBDBXBAMQGJVKH-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.65 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze N-[2-chloro-4-(2,3-dichlorophenyl)phenyl]-2-cyano-3-oxobutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-chloro-4-(2,3-dichlorophenyl)phenyl]-2-cyano-3-oxobutanamide?
The IUPAC name of N-[2-chloro-4-(2,3-dichlorophenyl)phenyl]-2-cyano-3-oxobutanamide (CID 91896056) is N-[2-chloro-4-(2,3-dichlorophenyl)phenyl]-2-cyano-3-oxobutanamide.
What is the SMILES notation for N-[2-chloro-4-(2,3-dichlorophenyl)phenyl]-2-cyano-3-oxobutanamide?
The canonical SMILES for N-[2-chloro-4-(2,3-dichlorophenyl)phenyl]-2-cyano-3-oxobutanamide is CC(=O)C(C#N)C(=O)Nc1ccc(-c2cccc(Cl)c2Cl)cc1Cl.
What is the InChIKey of N-[2-chloro-4-(2,3-dichlorophenyl)phenyl]-2-cyano-3-oxobutanamide?
The InChIKey is CBDBXBAMQGJVKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11Cl3N2O2/c1-9(23)12(8-21)17(24)22-15-6-5-10(7-14(15)19)11-3-2-4-13(18)16(11)20/h2-7,12H,1H3,(H,22,24).
What are the key properties of N-[2-chloro-4-(2,3-dichlorophenyl)phenyl]-2-cyano-3-oxobutanamide?
N-[2-chloro-4-(2,3-dichlorophenyl)phenyl]-2-cyano-3-oxobutanamide has a molecular weight of 381.65 g/mol, XLogP of 4.98, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-chloro-4-(2,3-dichlorophenyl)phenyl]-2-cyano-3-oxobutanamide is sourced from PubChem (CID 91896056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).