C18H17N3O2S — CID 91896207
5-(4-methylphenyl)-2-sulfanylidene-1,5,5a,7,8,9-hexahydropyrimido[4,5-b]quinoline-4,6-dione (PubChem CID 91896207) has the molecular formula C18H17N3O2S and a molecular weight of 339.42 g/mol. Its IUPAC name is 5-(4-methylphenyl)-2-sulfanylidene-1,5,5a,7,8,9-hexahydropyrimido[4,5-b]quinoline-4,6-dione.
| Compound Name | 5-(4-methylphenyl)-2-sulfanylidene-1,5,5a,7,8,9-hexahydropyrimido[4,5-b]quinoline-4,6-dione |
|---|---|
| PubChem CID | 91896207 |
| Molecular Formula | C18H17N3O2S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 5-(4-methylphenyl)-2-sulfanylidene-1,5,5a,7,8,9-hexahydropyrimido[4,5-b]quinoline-4,6-dione |
| SMILES | Cc1ccc(C2c3c([nH]c(=S)[nH]c3=O)N=C3CCCC(=O)C32)cc1 |
| InChI | InChI=1S/C18H17N3O2S/c1-9-5-7-10(8-6-9)13-14-11(3-2-4-12(14)22)19-16-15(13)17(23)21-18(24)20-16/h5-8,13-14H,2-4H2,1H3,(H2,20,21,23,24) |
| InChIKey | SYIMTEHNJUINLP-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 78.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|