C18H17ClN2O4 — CID 91896274
methyl 4-(4-chlorophenyl)-2-imino-6,7-dimethyl-5-oxo-3,4-dihydropyrano[3,2-c]pyridine-3-carboxylate (PubChem CID 91896274) has the molecular formula C18H17ClN2O4 and a molecular weight of 360.80 g/mol. Its IUPAC name is methyl 4-(4-chlorophenyl)-2-imino-6,7-dimethyl-5-oxo-3,4-dihydropyrano[3,2-c]pyridine-3-carboxylate.
| Compound Name | methyl 4-(4-chlorophenyl)-2-imino-6,7-dimethyl-5-oxo-3,4-dihydropyrano[3,2-c]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 91896274 |
| Molecular Formula | C18H17ClN2O4 |
| Molecular Weight | 360.80 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | methyl 4-(4-chlorophenyl)-2-imino-6,7-dimethyl-5-oxo-3,4-dihydropyrano[3,2-c]pyridine-3-carboxylate |
| SMILES | [H]/N=C1\Oc2cc(C)n(C)c(=O)c2C(c2ccc(Cl)cc2)C1C(=O)OC |
| InChI | InChI=1S/C18H17ClN2O4/c1-9-8-12-14(17(22)21(9)2)13(10-4-6-11(19)7-5-10)15(16(20)25-12)18(23)24-3/h4-8,13,15,20H,1-3H3/b20-16- |
| InChIKey | MJSVCSSZGQDVCG-SILNSSARSA-N |
| XLogP | 2.64 |
| TPSA | 81.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.80 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|