C21H25N3O5S — CID 91896319
4-(2,4-dimethyl-1,3-thiazole-5-carbonyl)-5-(5-methylfuran-2-yl)-1-(2-morpholin-4-ylethyl)pyrrolidine-2,3-dione (PubChem CID 91896319) has the molecular formula C21H25N3O5S and a molecular weight of 431.51 g/mol. Its IUPAC name is 4-(2,4-dimethyl-1,3-thiazole-5-carbonyl)-5-(5-methylfuran-2-yl)-1-(2-morpholin-4-ylethyl)pyrrolidine-2,3-dione.
| Compound Name | 4-(2,4-dimethyl-1,3-thiazole-5-carbonyl)-5-(5-methylfuran-2-yl)-1-(2-morpholin-4-ylethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 91896319 |
| Molecular Formula | C21H25N3O5S |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 4-(2,4-dimethyl-1,3-thiazole-5-carbonyl)-5-(5-methylfuran-2-yl)-1-(2-morpholin-4-ylethyl)pyrrolidine-2,3-dione |
| SMILES | Cc1ccc(C2C(C(=O)c3sc(C)nc3C)C(=O)C(=O)N2CCN2CCOCC2)o1 |
| InChI | InChI=1S/C21H25N3O5S/c1-12-4-5-15(29-12)17-16(18(25)20-13(2)22-14(3)30-20)19(26)21(27)24(17)7-6-23-8-10-28-11-9-23/h4-5,16-17H,6-11H2,1-3H3 |
| InChIKey | ASCJKQMJZOBPAI-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 92.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|