C15H9BrF3NO3 — CID 91896567
2-[(4-bromophenyl)iminomethyl]-4,4,4-trifluoro-1-(furan-2-yl)butane-1,3-dione (PubChem CID 91896567) has the molecular formula C15H9BrF3NO3 and a molecular weight of 388.14 g/mol. Its IUPAC name is 2-[(4-bromophenyl)iminomethyl]-4,4,4-trifluoro-1-(furan-2-yl)butane-1,3-dione.
| Compound Name | 2-[(4-bromophenyl)iminomethyl]-4,4,4-trifluoro-1-(furan-2-yl)butane-1,3-dione |
|---|---|
| PubChem CID | 91896567 |
| Molecular Formula | C15H9BrF3NO3 |
| Molecular Weight | 388.14 g/mol |
| Exact Mass | 386.97 |
| IUPAC Name | 2-[(4-bromophenyl)iminomethyl]-4,4,4-trifluoro-1-(furan-2-yl)butane-1,3-dione |
| SMILES | O=C(c1ccco1)C(/C=N/c1ccc(Br)cc1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C15H9BrF3NO3/c16-9-3-5-10(6-4-9)20-8-11(14(22)15(17,18)19)13(21)12-2-1-7-23-12/h1-8,11H/b20-8+ |
| InChIKey | GVUREZTYQGTEBD-DNTJNYDQSA-N |
| XLogP | 4.37 |
| TPSA | 59.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.14 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|