C25H20N2O2 — CID 91897617
4,7-diphenyl-2-pyridin-4-yl-4,7-dihydroisoindole-1,3-diol (PubChem CID 91897617) has the molecular formula C25H20N2O2 and a molecular weight of 380.45 g/mol. Its IUPAC name is 4,7-diphenyl-2-pyridin-4-yl-4,7-dihydroisoindole-1,3-diol.
| Compound Name | 4,7-diphenyl-2-pyridin-4-yl-4,7-dihydroisoindole-1,3-diol |
|---|---|
| PubChem CID | 91897617 |
| Molecular Formula | C25H20N2O2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 4,7-diphenyl-2-pyridin-4-yl-4,7-dihydroisoindole-1,3-diol |
| SMILES | Oc1c2c(c(O)n1-c1ccncc1)C(c1ccccc1)C=CC2c1ccccc1 |
| InChI | InChI=1S/C25H20N2O2/c28-24-22-20(17-7-3-1-4-8-17)11-12-21(18-9-5-2-6-10-18)23(22)25(29)27(24)19-13-15-26-16-14-19/h1-16,20-21,28-29H |
| InChIKey | WHNBGAWJGOWPGG-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|