C14H11F4N3O — CID 91897690
1-(4-methoxyphenyl)ethyl-(2,3,5,6-tetrafluoro-4-pyridinyl)diazene (PubChem CID 91897690) has the molecular formula C14H11F4N3O and a molecular weight of 313.25 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)ethyl-(2,3,5,6-tetrafluoro-4-pyridinyl)diazene.
| Compound Name | 1-(4-methoxyphenyl)ethyl-(2,3,5,6-tetrafluoro-4-pyridinyl)diazene |
|---|---|
| PubChem CID | 91897690 |
| Molecular Formula | C14H11F4N3O |
| Molecular Weight | 313.25 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 1-(4-methoxyphenyl)ethyl-(2,3,5,6-tetrafluoro-4-pyridinyl)diazene |
| SMILES | COc1ccc(C(C)/N=N/c2c(F)c(F)nc(F)c2F)cc1 |
| InChI | InChI=1S/C14H11F4N3O/c1-7(8-3-5-9(22-2)6-4-8)20-21-12-10(15)13(17)19-14(18)11(12)16/h3-7H,1-2H3/b21-20+ |
| InChIKey | BCFZLAYIPUNVPL-QZQOTICOSA-N |
| XLogP | 4.49 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.25 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|