C17H16N2O5S — CID 91897799
4-acetyl-5-(2,4-dimethoxyphenyl)-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione (PubChem CID 91897799) has the molecular formula C17H16N2O5S and a molecular weight of 360.39 g/mol. Its IUPAC name is 4-acetyl-5-(2,4-dimethoxyphenyl)-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione.
| Compound Name | 4-acetyl-5-(2,4-dimethoxyphenyl)-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 91897799 |
| Molecular Formula | C17H16N2O5S |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 4-acetyl-5-(2,4-dimethoxyphenyl)-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione |
| SMILES | COc1ccc(C2C(C(C)=O)C(=O)C(=O)N2c2nccs2)c(OC)c1 |
| InChI | InChI=1S/C17H16N2O5S/c1-9(20)13-14(11-5-4-10(23-2)8-12(11)24-3)19(16(22)15(13)21)17-18-6-7-25-17/h4-8,13-14H,1-3H3 |
| InChIKey | WXFQKXPFULXBLO-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|