C19H20N4O5 — CID 91897881
ethyl 2-[5-cyano-4-(2,3-dimethoxyphenyl)-6-imino-4,5-dihydro-2H-pyrano[2,3-c]pyrazol-3-yl]acetate (PubChem CID 91897881) has the molecular formula C19H20N4O5 and a molecular weight of 384.39 g/mol. Its IUPAC name is ethyl 2-[5-cyano-4-(2,3-dimethoxyphenyl)-6-imino-4,5-dihydro-2H-pyrano[2,3-c]pyrazol-3-yl]acetate.
| Compound Name | ethyl 2-[5-cyano-4-(2,3-dimethoxyphenyl)-6-imino-4,5-dihydro-2H-pyrano[2,3-c]pyrazol-3-yl]acetate |
|---|---|
| PubChem CID | 91897881 |
| Molecular Formula | C19H20N4O5 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | ethyl 2-[5-cyano-4-(2,3-dimethoxyphenyl)-6-imino-4,5-dihydro-2H-pyrano[2,3-c]pyrazol-3-yl]acetate |
| SMILES | [H]/N=C1\Oc2n[nH]c(CC(=O)OCC)c2C(c2cccc(OC)c2OC)C1C#N |
| InChI | InChI=1S/C19H20N4O5/c1-4-27-14(24)8-12-16-15(10-6-5-7-13(25-2)17(10)26-3)11(9-20)18(21)28-19(16)23-22-12/h5-7,11,15,21H,4,8H2,1-3H3,(H,22,23)/b21-18- |
| InChIKey | UIQCPLQPYDQUOM-UZYVYHOESA-N |
| XLogP | 2.17 |
| TPSA | 130.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|