C12H14N4O2 — CID 91897897
6-imino-3-methylspiro[2,5-dihydropyrano[2,3-c]pyrazole-4,4'-oxane]-5-carbonitrile (PubChem CID 91897897) has the molecular formula C12H14N4O2 and a molecular weight of 246.27 g/mol. Its IUPAC name is 6-imino-3-methylspiro[2,5-dihydropyrano[2,3-c]pyrazole-4,4'-oxane]-5-carbonitrile.
| Compound Name | 6-imino-3-methylspiro[2,5-dihydropyrano[2,3-c]pyrazole-4,4'-oxane]-5-carbonitrile |
|---|---|
| PubChem CID | 91897897 |
| Molecular Formula | C12H14N4O2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 6-imino-3-methylspiro[2,5-dihydropyrano[2,3-c]pyrazole-4,4'-oxane]-5-carbonitrile |
| SMILES | [H]/N=C1\Oc2n[nH]c(C)c2C2(CCOCC2)C1C#N |
| InChI | InChI=1S/C12H14N4O2/c1-7-9-11(16-15-7)18-10(14)8(6-13)12(9)2-4-17-5-3-12/h8,14H,2-5H2,1H3,(H,15,16)/b14-10- |
| InChIKey | KNZOIWSORNHSKH-UVTDQMKNSA-N |
| XLogP | 1.28 |
| TPSA | 94.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|