C22H23NO7 — CID 91898081
5-(3,4-dimethoxyphenyl)-4-(furan-2-carbonyl)-1-(oxolan-2-ylmethyl)pyrrolidine-2,3-dione (PubChem CID 91898081) has the molecular formula C22H23NO7 and a molecular weight of 413.43 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenyl)-4-(furan-2-carbonyl)-1-(oxolan-2-ylmethyl)pyrrolidine-2,3-dione.
| Compound Name | 5-(3,4-dimethoxyphenyl)-4-(furan-2-carbonyl)-1-(oxolan-2-ylmethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 91898081 |
| Molecular Formula | C22H23NO7 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 5-(3,4-dimethoxyphenyl)-4-(furan-2-carbonyl)-1-(oxolan-2-ylmethyl)pyrrolidine-2,3-dione |
| SMILES | COc1ccc(C2C(C(=O)c3ccco3)C(=O)C(=O)N2CC2CCCO2)cc1OC |
| InChI | InChI=1S/C22H23NO7/c1-27-15-8-7-13(11-17(15)28-2)19-18(20(24)16-6-4-10-30-16)21(25)22(26)23(19)12-14-5-3-9-29-14/h4,6-8,10-11,14,18-19H,3,5,9,12H2,1-2H3 |
| InChIKey | IQGODOYFXZSWNI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 95.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|