C21H21NO3 — CID 91898165
2-(2-methoxyphenyl)-5-phenyl-4,5,6,7-tetrahydroisoindole-1,3-diol (PubChem CID 91898165) has the molecular formula C21H21NO3 and a molecular weight of 335.40 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)-5-phenyl-4,5,6,7-tetrahydroisoindole-1,3-diol.
| Compound Name | 2-(2-methoxyphenyl)-5-phenyl-4,5,6,7-tetrahydroisoindole-1,3-diol |
|---|---|
| PubChem CID | 91898165 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 2-(2-methoxyphenyl)-5-phenyl-4,5,6,7-tetrahydroisoindole-1,3-diol |
| SMILES | COc1ccccc1-n1c(O)c2c(c1O)CC(c1ccccc1)CC2 |
| InChI | InChI=1S/C21H21NO3/c1-25-19-10-6-5-9-18(19)22-20(23)16-12-11-15(13-17(16)21(22)24)14-7-3-2-4-8-14/h2-10,15,23-24H,11-13H2,1H3 |
| InChIKey | KFHJASRSEBXMPI-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 54.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |