C9H8Br2N6O — CID 91898331
2-[[(4-amino-1,2,4-triazol-3-yl)diazenyl]methyl]-4,6-dibromophenol (PubChem CID 91898331) has the molecular formula C9H8Br2N6O and a molecular weight of 376.01 g/mol. Its IUPAC name is 2-[[(4-amino-1,2,4-triazol-3-yl)diazenyl]methyl]-4,6-dibromophenol.
| Compound Name | 2-[[(4-amino-1,2,4-triazol-3-yl)diazenyl]methyl]-4,6-dibromophenol |
|---|---|
| PubChem CID | 91898331 |
| Molecular Formula | C9H8Br2N6O |
| Molecular Weight | 376.01 g/mol |
| Exact Mass | 373.91 |
| IUPAC Name | 2-[[(4-amino-1,2,4-triazol-3-yl)diazenyl]methyl]-4,6-dibromophenol |
| SMILES | Nn1cnnc1/N=N/Cc1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C9H8Br2N6O/c10-6-1-5(8(18)7(11)2-6)3-13-15-9-16-14-4-17(9)12/h1-2,4,18H,3,12H2/b15-13+ |
| InChIKey | XPLHPBZBZOSSHR-FYWRMAATSA-N |
| XLogP | 2.51 |
| TPSA | 101.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.01 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|