About (5-acetyloxy-9,10-dihydroxy-1,4-dihydroanthracen-1-yl) acetate
(5-acetyloxy-9,10-dihydroxy-1,4-dihydroanthracen-1-yl) acetate (PubChem CID 91898332) has the molecular formula C18H16O6
and a molecular weight of 328.32 g/mol. Its IUPAC name is (5-acetyloxy-9,10-dihydroxy-1,4-dihydroanthracen-1-yl) acetate.
Molecular Properties
| Compound Name | (5-acetyloxy-9,10-dihydroxy-1,4-dihydroanthracen-1-yl) acetate |
| PubChem CID | 91898332 |
| Molecular Formula | C18H16O6 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | (5-acetyloxy-9,10-dihydroxy-1,4-dihydroanthracen-1-yl) acetate |
| SMILES | CC(=O)Oc1cccc2c(O)c3c(c(O)c12)CC=CC3OC(C)=O |
| InChI | InChI=1S/C18H16O6/c1-9(19)23-13-7-3-5-11-15(13)17(21)12-6-4-8-14(24-10(2)20)16(12)18(11)22/h3-5,7-8,14,21-22H,6H2,1-2H3 |
| InChIKey | NIFIDSHKADQUCS-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (5-acetyloxy-9,10-dihydroxy-1,4-dihydroanthracen-1-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-acetyloxy-9,10-dihydroxy-1,4-dihydroanthracen-1-yl) acetate?
The IUPAC name of (5-acetyloxy-9,10-dihydroxy-1,4-dihydroanthracen-1-yl) acetate (CID 91898332) is (5-acetyloxy-9,10-dihydroxy-1,4-dihydroanthracen-1-yl) acetate.
What is the SMILES notation for (5-acetyloxy-9,10-dihydroxy-1,4-dihydroanthracen-1-yl) acetate?
The canonical SMILES for (5-acetyloxy-9,10-dihydroxy-1,4-dihydroanthracen-1-yl) acetate is CC(=O)Oc1cccc2c(O)c3c(c(O)c12)CC=CC3OC(C)=O.
What is the InChIKey of (5-acetyloxy-9,10-dihydroxy-1,4-dihydroanthracen-1-yl) acetate?
The InChIKey is NIFIDSHKADQUCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16O6/c1-9(19)23-13-7-3-5-11-15(13)17(21)12-6-4-8-14(24-10(2)20)16(12)18(11)22/h3-5,7-8,14,21-22H,6H2,1-2H3.
What are the key properties of (5-acetyloxy-9,10-dihydroxy-1,4-dihydroanthracen-1-yl) acetate?
(5-acetyloxy-9,10-dihydroxy-1,4-dihydroanthracen-1-yl) acetate has a molecular weight of 328.32 g/mol, XLogP of 2.89, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5-acetyloxy-9,10-dihydroxy-1,4-dihydroanthracen-1-yl) acetate is sourced from PubChem (CID 91898332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).