C30H35Cl2N7O4 — CID 91898352
N-[3-[[3-(2,6-dichloro-3,5-dimethoxyphenyl)-7-[4-(ethylamino)butylamino]-2-oxo-4H-pyrimido[4,5-d]pyrimidin-1-yl]methyl]phenyl]prop-2-enamide (PubChem CID 91898352) has the molecular formula C30H35Cl2N7O4 and a molecular weight of 628.56 g/mol. Its IUPAC name is N-[3-[[3-(2,6-dichloro-3,5-dimethoxyphenyl)-7-[4-(ethylamino)butylamino]-2-oxo-4H-pyrimido[4,5-d]pyrimidin-1-yl]methyl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[3-(2,6-dichloro-3,5-dimethoxyphenyl)-7-[4-(ethylamino)butylamino]-2-oxo-4H-pyrimido[4,5-d]pyrimidin-1-yl]methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 91898352 |
| Molecular Formula | C30H35Cl2N7O4 |
| Molecular Weight | 628.56 g/mol |
| Exact Mass | 627.21 |
| IUPAC Name | N-[3-[[3-(2,6-dichloro-3,5-dimethoxyphenyl)-7-[4-(ethylamino)butylamino]-2-oxo-4H-pyrimido[4,5-d]pyrimidin-1-yl]methyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(CN2C(=O)N(c3c(Cl)c(OC)cc(OC)c3Cl)Cc3cnc(NCCCCNCC)nc32)c1 |
| InChI | InChI=1S/C30H35Cl2N7O4/c1-5-24(40)36-21-11-9-10-19(14-21)17-39-28-20(16-35-29(37-28)34-13-8-7-12-33-6-2)18-38(30(39)41)27-25(31)22(42-3)15-23(43-4)26(27)32/h5,9-11,14-16,33H,1,6-8,12-13,17-18H2,2-4H3,(H,36,40)(H,34,35,37) |
| InChIKey | DXQBCGUEDOHNHP-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 120.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.56 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|