C20H32O4 — CID 91898397
(Z)-6-[(1R,4S,5S,6R)-6-[(E,3S)-3-hydroxyoct-1-enyl]-2-oxabicyclo[2.2.1]heptan-5-yl]hex-5-enoic acid (PubChem CID 91898397) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is (Z)-6-[(1R,4S,5S,6R)-6-[(E,3S)-3-hydroxyoct-1-enyl]-2-oxabicyclo[2.2.1]heptan-5-yl]hex-5-enoic acid.
| Compound Name | (Z)-6-[(1R,4S,5S,6R)-6-[(E,3S)-3-hydroxyoct-1-enyl]-2-oxabicyclo[2.2.1]heptan-5-yl]hex-5-enoic acid |
|---|---|
| PubChem CID | 91898397 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | (Z)-6-[(1R,4S,5S,6R)-6-[(E,3S)-3-hydroxyoct-1-enyl]-2-oxabicyclo[2.2.1]heptan-5-yl]hex-5-enoic acid |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1[C@@H](/C=C\CCCC(=O)O)[C@H]2CO[C@@H]1C2 |
| InChI | InChI=1S/C20H32O4/c1-2-3-5-8-16(21)11-12-18-17(15-13-19(18)24-14-15)9-6-4-7-10-20(22)23/h6,9,11-12,15-19,21H,2-5,7-8,10,13-14H2,1H3,(H,22,23)/b9-6-,12-11+/t15-,16+,17+,18-,19-/m1/s1 |
| InChIKey | DLSJSZVOTKYJET-QNNYBNNASA-N |
| XLogP | 3.95 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|