C26H32N2O — CID 91898882
(3E,12R,13R)-13-propan-2-yl-15-[5-(1H-pyrrol-2-yl)furan-2-yl]-2-azatricyclo[10.2.1.13,14]hexadeca-1(15),3,14(16)-triene (PubChem CID 91898882) has the molecular formula C26H32N2O and a molecular weight of 388.56 g/mol. Its IUPAC name is (3E,12R,13R)-13-propan-2-yl-15-[5-(1H-pyrrol-2-yl)furan-2-yl]-2-azatricyclo[10.2.1.13,14]hexadeca-1(15),3,14(16)-triene.
| Compound Name | (3E,12R,13R)-13-propan-2-yl-15-[5-(1H-pyrrol-2-yl)furan-2-yl]-2-azatricyclo[10.2.1.13,14]hexadeca-1(15),3,14(16)-triene |
|---|---|
| PubChem CID | 91898882 |
| Molecular Formula | C26H32N2O |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | (3E,12R,13R)-13-propan-2-yl-15-[5-(1H-pyrrol-2-yl)furan-2-yl]-2-azatricyclo[10.2.1.13,14]hexadeca-1(15),3,14(16)-triene |
| SMILES | CC(C)[C@H]1c2c/c3[nH]c2=C(c2ccc(-c4ccc[nH]4)o2)[C@@H]1CCCCCCC/C=3 |
| InChI | InChI=1S/C26H32N2O/c1-17(2)24-19-11-8-6-4-3-5-7-10-18-16-20(24)26(28-18)25(19)23-14-13-22(29-23)21-12-9-15-27-21/h9-10,12-17,19,24,27-28H,3-8,11H2,1-2H3/b18-10-/t19-,24-/m1/s1 |
| InChIKey | VMEJBCZQKLECCR-FQCMYUJCSA-N |
| XLogP | 5.70 |
| TPSA | 44.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |