C19H15N3O4 — CID 91899457
1,3-benzodioxol-5-ylmethyl-(6-methyl-[1,3]dioxolo[4,5-g]quinolin-8-yl)diazene (PubChem CID 91899457) has the molecular formula C19H15N3O4 and a molecular weight of 349.35 g/mol. Its IUPAC name is 1,3-benzodioxol-5-ylmethyl-(6-methyl-[1,3]dioxolo[4,5-g]quinolin-8-yl)diazene.
| Compound Name | 1,3-benzodioxol-5-ylmethyl-(6-methyl-[1,3]dioxolo[4,5-g]quinolin-8-yl)diazene |
|---|---|
| PubChem CID | 91899457 |
| Molecular Formula | C19H15N3O4 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 1,3-benzodioxol-5-ylmethyl-(6-methyl-[1,3]dioxolo[4,5-g]quinolin-8-yl)diazene |
| SMILES | Cc1cc(/N=N/Cc2ccc3c(c2)OCO3)c2cc3c(cc2n1)OCO3 |
| InChI | InChI=1S/C19H15N3O4/c1-11-4-15(13-6-18-19(26-10-25-18)7-14(13)21-11)22-20-8-12-2-3-16-17(5-12)24-9-23-16/h2-7H,8-10H2,1H3/b22-20+ |
| InChIKey | TWQKODMNYCKFPK-LSDHQDQOSA-N |
| XLogP | 4.28 |
| TPSA | 74.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|