C23H21N5O3 — CID 91899459
1,5-dimethyl-4-[[(6-methyl-[1,3]dioxolo[4,5-g]quinolin-8-yl)diazenyl]methyl]-2-phenylpyrazol-3-one (PubChem CID 91899459) has the molecular formula C23H21N5O3 and a molecular weight of 415.45 g/mol. Its IUPAC name is 1,5-dimethyl-4-[[(6-methyl-[1,3]dioxolo[4,5-g]quinolin-8-yl)diazenyl]methyl]-2-phenylpyrazol-3-one.
| Compound Name | 1,5-dimethyl-4-[[(6-methyl-[1,3]dioxolo[4,5-g]quinolin-8-yl)diazenyl]methyl]-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 91899459 |
| Molecular Formula | C23H21N5O3 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 1,5-dimethyl-4-[[(6-methyl-[1,3]dioxolo[4,5-g]quinolin-8-yl)diazenyl]methyl]-2-phenylpyrazol-3-one |
| SMILES | Cc1cc(/N=N/Cc2c(C)n(C)n(-c3ccccc3)c2=O)c2cc3c(cc2n1)OCO3 |
| InChI | InChI=1S/C23H21N5O3/c1-14-9-20(17-10-21-22(31-13-30-21)11-19(17)25-14)26-24-12-18-15(2)27(3)28(23(18)29)16-7-5-4-6-8-16/h4-11H,12-13H2,1-3H3/b26-24+ |
| InChIKey | IWGQRLOAJLHPDK-SHHOIMCASA-N |
| XLogP | 4.35 |
| TPSA | 83.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|