C21H22F3N3O3 — CID 91899462
5-(4-aminobutylideneamino)-1,2-dimethyl-3-[(2,4,6-trifluorophenoxy)methyl]indole-4,7-diol (PubChem CID 91899462) has the molecular formula C21H22F3N3O3 and a molecular weight of 421.42 g/mol. Its IUPAC name is 5-(4-aminobutylideneamino)-1,2-dimethyl-3-[(2,4,6-trifluorophenoxy)methyl]indole-4,7-diol.
| Compound Name | 5-(4-aminobutylideneamino)-1,2-dimethyl-3-[(2,4,6-trifluorophenoxy)methyl]indole-4,7-diol |
|---|---|
| PubChem CID | 91899462 |
| Molecular Formula | C21H22F3N3O3 |
| Molecular Weight | 421.42 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 5-(4-aminobutylideneamino)-1,2-dimethyl-3-[(2,4,6-trifluorophenoxy)methyl]indole-4,7-diol |
| SMILES | Cc1c(COc2c(F)cc(F)cc2F)c2c(O)c(/N=C/CCCN)cc(O)c2n1C |
| InChI | InChI=1S/C21H22F3N3O3/c1-11-13(10-30-21-14(23)7-12(22)8-15(21)24)18-19(27(11)2)17(28)9-16(20(18)29)26-6-4-3-5-25/h6-9,28-29H,3-5,10,25H2,1-2H3/b26-6+ |
| InChIKey | LYXABYFQCTZZRC-GOTRBWPWSA-N |
| XLogP | 4.34 |
| TPSA | 93.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.42 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|