C20H20F3N3O3 — CID 91899464
5-(3-aminopropylideneamino)-1,2-dimethyl-3-[(2,4,6-trifluorophenoxy)methyl]indole-4,7-diol (PubChem CID 91899464) has the molecular formula C20H20F3N3O3 and a molecular weight of 407.39 g/mol. Its IUPAC name is 5-(3-aminopropylideneamino)-1,2-dimethyl-3-[(2,4,6-trifluorophenoxy)methyl]indole-4,7-diol.
| Compound Name | 5-(3-aminopropylideneamino)-1,2-dimethyl-3-[(2,4,6-trifluorophenoxy)methyl]indole-4,7-diol |
|---|---|
| PubChem CID | 91899464 |
| Molecular Formula | C20H20F3N3O3 |
| Molecular Weight | 407.39 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 5-(3-aminopropylideneamino)-1,2-dimethyl-3-[(2,4,6-trifluorophenoxy)methyl]indole-4,7-diol |
| SMILES | Cc1c(COc2c(F)cc(F)cc2F)c2c(O)c(/N=C/CCN)cc(O)c2n1C |
| InChI | InChI=1S/C20H20F3N3O3/c1-10-12(9-29-20-13(22)6-11(21)7-14(20)23)17-18(26(10)2)16(27)8-15(19(17)28)25-5-3-4-24/h5-8,27-28H,3-4,9,24H2,1-2H3/b25-5+ |
| InChIKey | GURAJXUGVRBLQT-VVAXDPKNSA-N |
| XLogP | 3.95 |
| TPSA | 93.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.39 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|